C17H19BrS2 — CID 81261943
2-[bromo-(2,4,6-trimethylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran (PubChem CID 81261943) has the molecular formula C17H19BrS2 and a molecular weight of 367.38 g/mol. Its IUPAC name is 2-[bromo-(2,4,6-trimethylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran.
| Compound Name | 2-[bromo-(2,4,6-trimethylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
|---|---|
| PubChem CID | 81261943 |
| Molecular Formula | C17H19BrS2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 2-[bromo-(2,4,6-trimethylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
| SMILES | Cc1cc(C)c(C(Br)c2cc3c(s2)CCSC3)c(C)c1 |
| InChI | InChI=1S/C17H19BrS2/c1-10-6-11(2)16(12(3)7-10)17(18)15-8-13-9-19-5-4-14(13)20-15/h6-8,17H,4-5,9H2,1-3H3 |
| InChIKey | LVCIWECCPMDQFZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|