C15H14BrFOS2 — CID 81260964
2-[bromo-(5-fluoro-2-methoxyphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran (PubChem CID 81260964) has the molecular formula C15H14BrFOS2 and a molecular weight of 373.31 g/mol. Its IUPAC name is 2-[bromo-(5-fluoro-2-methoxyphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran.
| Compound Name | 2-[bromo-(5-fluoro-2-methoxyphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
|---|---|
| PubChem CID | 81260964 |
| Molecular Formula | C15H14BrFOS2 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 2-[bromo-(5-fluoro-2-methoxyphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
| SMILES | COc1ccc(F)cc1C(Br)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C15H14BrFOS2/c1-18-12-3-2-10(17)7-11(12)15(16)14-6-9-8-19-5-4-13(9)20-14/h2-3,6-7,15H,4-5,8H2,1H3 |
| InChIKey | XZMXNDFQAQNIOT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|