C16H17ClO2S2 — CID 81267138
2-[chloro-(3,4-dimethoxyphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran (PubChem CID 81267138) has the molecular formula C16H17ClO2S2 and a molecular weight of 340.90 g/mol. Its IUPAC name is 2-[chloro-(3,4-dimethoxyphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran.
| Compound Name | 2-[chloro-(3,4-dimethoxyphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
|---|---|
| PubChem CID | 81267138 |
| Molecular Formula | C16H17ClO2S2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-[chloro-(3,4-dimethoxyphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
| SMILES | COc1ccc(C(Cl)c2cc3c(s2)CCSC3)cc1OC |
| InChI | InChI=1S/C16H17ClO2S2/c1-18-12-4-3-10(7-13(12)19-2)16(17)15-8-11-9-20-6-5-14(11)21-15/h3-4,7-8,16H,5-6,9H2,1-2H3 |
| InChIKey | QJJHPGJNQOOIRS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|