C12H9BrCl2S3 — CID 102836680
2-[(4-bromo-5-chlorothiophen-2-yl)-chloromethyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran (PubChem CID 102836680) has the molecular formula C12H9BrCl2S3 and a molecular weight of 400.22 g/mol. Its IUPAC name is 2-[(4-bromo-5-chlorothiophen-2-yl)-chloromethyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran.
| Compound Name | 2-[(4-bromo-5-chlorothiophen-2-yl)-chloromethyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
|---|---|
| PubChem CID | 102836680 |
| Molecular Formula | C12H9BrCl2S3 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 397.84 |
| IUPAC Name | 2-[(4-bromo-5-chlorothiophen-2-yl)-chloromethyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
| SMILES | Clc1sc(C(Cl)c2cc3c(s2)CCSC3)cc1Br |
| InChI | InChI=1S/C12H9BrCl2S3/c13-7-4-10(18-12(7)15)11(14)9-3-6-5-16-2-1-8(6)17-9/h3-4,11H,1-2,5H2 |
| InChIKey | SIILEJBYVVMIPR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|