C14H10ClF3S2 — CID 81261326
2-[chloro-(2,4,6-trifluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran (PubChem CID 81261326) has the molecular formula C14H10ClF3S2 and a molecular weight of 334.82 g/mol. Its IUPAC name is 2-[chloro-(2,4,6-trifluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran.
| Compound Name | 2-[chloro-(2,4,6-trifluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
|---|---|
| PubChem CID | 81261326 |
| Molecular Formula | C14H10ClF3S2 |
| Molecular Weight | 334.82 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 2-[chloro-(2,4,6-trifluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
| SMILES | Fc1cc(F)c(C(Cl)c2cc3c(s2)CCSC3)c(F)c1 |
| InChI | InChI=1S/C14H10ClF3S2/c15-14(13-9(17)4-8(16)5-10(13)18)12-3-7-6-19-2-1-11(7)20-12/h3-5,14H,1-2,6H2 |
| InChIKey | IVLLMTDZXZUIOU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.82 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|