C12H13BrN2S3 — CID 105322532
[(4-bromothiophen-3-yl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methyl]hydrazine (PubChem CID 105322532) has the molecular formula C12H13BrN2S3 and a molecular weight of 361.36 g/mol. Its IUPAC name is [(4-bromothiophen-3-yl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methyl]hydrazine.
| Compound Name | [(4-bromothiophen-3-yl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105322532 |
| Molecular Formula | C12H13BrN2S3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | [(4-bromothiophen-3-yl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methyl]hydrazine |
| SMILES | NNC(c1cc2c(s1)CCSC2)c1cscc1Br |
| InChI | InChI=1S/C12H13BrN2S3/c13-9-6-17-5-8(9)12(15-14)11-3-7-4-16-2-1-10(7)18-11/h3,5-6,12,15H,1-2,4,14H2 |
| InChIKey | OZDXCFUEAYPKNF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|