C13H16N2S3 — CID 105322322
[6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl-(3-methylthiophen-2-yl)methyl]hydrazine (PubChem CID 105322322) has the molecular formula C13H16N2S3 and a molecular weight of 296.49 g/mol. Its IUPAC name is [6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl-(3-methylthiophen-2-yl)methyl]hydrazine.
| Compound Name | [6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl-(3-methylthiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105322322 |
| Molecular Formula | C13H16N2S3 |
| Molecular Weight | 296.49 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | [6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl-(3-methylthiophen-2-yl)methyl]hydrazine |
| SMILES | Cc1ccsc1C(NN)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C13H16N2S3/c1-8-2-5-17-13(8)12(15-14)11-6-9-7-16-4-3-10(9)18-11/h2,5-6,12,15H,3-4,7,14H2,1H3 |
| InChIKey | AQPVXBVNNVXVFF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|