C17H17BrO — CID 107983332
(2-bromo-3-methylphenyl)-(2,3-dihydro-1H-inden-5-yl)methanol (PubChem CID 107983332) has the molecular formula C17H17BrO and a molecular weight of 317.23 g/mol. Its IUPAC name is (2-bromo-3-methylphenyl)-(2,3-dihydro-1H-inden-5-yl)methanol.
| Compound Name | (2-bromo-3-methylphenyl)-(2,3-dihydro-1H-inden-5-yl)methanol |
|---|---|
| PubChem CID | 107983332 |
| Molecular Formula | C17H17BrO |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (2-bromo-3-methylphenyl)-(2,3-dihydro-1H-inden-5-yl)methanol |
| SMILES | Cc1cccc(C(O)c2ccc3c(c2)CCC3)c1Br |
| InChI | InChI=1S/C17H17BrO/c1-11-4-2-7-15(16(11)18)17(19)14-9-8-12-5-3-6-13(12)10-14/h2,4,7-10,17,19H,3,5-6H2,1H3 |
| InChIKey | YCZDFNRQPFVKJN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |