C11H6Cl3FS — CID 63436567
2,5-dichloro-3-[chloro-(2-fluorophenyl)methyl]thiophene (PubChem CID 63436567) has the molecular formula C11H6Cl3FS and a molecular weight of 295.59 g/mol. Its IUPAC name is 2,5-dichloro-3-[chloro-(2-fluorophenyl)methyl]thiophene.
| Compound Name | 2,5-dichloro-3-[chloro-(2-fluorophenyl)methyl]thiophene |
|---|---|
| PubChem CID | 63436567 |
| Molecular Formula | C11H6Cl3FS |
| Molecular Weight | 295.59 g/mol |
| Exact Mass | 293.92 |
| IUPAC Name | 2,5-dichloro-3-[chloro-(2-fluorophenyl)methyl]thiophene |
| SMILES | Fc1ccccc1C(Cl)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H6Cl3FS/c12-9-5-7(11(14)16-9)10(13)6-3-1-2-4-8(6)15/h1-5,10H |
| InChIKey | YBJZMCKNYAZPJU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|