C8H11BrClNO2S2 — CID 102828055
1-(4-bromo-5-chlorothiophen-2-yl)-2-methylsulfonylpropan-1-amine (PubChem CID 102828055) has the molecular formula C8H11BrClNO2S2 and a molecular weight of 332.67 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-2-methylsulfonylpropan-1-amine.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 102828055 |
| Molecular Formula | C8H11BrClNO2S2 |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 330.91 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-methylsulfonylpropan-1-amine |
| SMILES | CC(C(N)c1cc(Br)c(Cl)s1)S(C)(=O)=O |
| InChI | InChI=1S/C8H11BrClNO2S2/c1-4(15(2,12)13)7(11)6-3-5(9)8(10)14-6/h3-4,7H,11H2,1-2H3 |
| InChIKey | SJAZXMOIXKYQAM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |