C13H10Br2N2OS — CID 80536215
5-[amino-(4,5-dibromothiophen-2-yl)methyl]-1,3-dihydroindol-2-one (PubChem CID 80536215) has the molecular formula C13H10Br2N2OS and a molecular weight of 402.11 g/mol. Its IUPAC name is 5-[amino-(4,5-dibromothiophen-2-yl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[amino-(4,5-dibromothiophen-2-yl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 80536215 |
| Molecular Formula | C13H10Br2N2OS |
| Molecular Weight | 402.11 g/mol |
| Exact Mass | 399.89 |
| IUPAC Name | 5-[amino-(4,5-dibromothiophen-2-yl)methyl]-1,3-dihydroindol-2-one |
| SMILES | NC(c1ccc2c(c1)CC(=O)N2)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H10Br2N2OS/c14-8-5-10(19-13(8)15)12(16)6-1-2-9-7(3-6)4-11(18)17-9/h1-3,5,12H,4,16H2,(H,17,18) |
| InChIKey | ODXICEFMVWKTJQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.11 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |