C18H24ClNO — CID 63433506
6-(1-chloro-3-cyclohexylpropyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 63433506) has the molecular formula C18H24ClNO and a molecular weight of 305.85 g/mol. Its IUPAC name is 6-(1-chloro-3-cyclohexylpropyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(1-chloro-3-cyclohexylpropyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 63433506 |
| Molecular Formula | C18H24ClNO |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 6-(1-chloro-3-cyclohexylpropyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(Cl)CCC3CCCCC3)ccc2N1 |
| InChI | InChI=1S/C18H24ClNO/c19-16(9-6-13-4-2-1-3-5-13)14-7-10-17-15(12-14)8-11-18(21)20-17/h7,10,12-13,16H,1-6,8-9,11H2,(H,20,21) |
| InChIKey | WDBLGXIECFXYKI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|