C18H22ClNO — CID 63433461
6-[2-(2-bicyclo[2.2.1]heptanyl)-1-chloroethyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 63433461) has the molecular formula C18H22ClNO and a molecular weight of 303.83 g/mol. Its IUPAC name is 6-[2-(2-bicyclo[2.2.1]heptanyl)-1-chloroethyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-(2-bicyclo[2.2.1]heptanyl)-1-chloroethyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 63433461 |
| Molecular Formula | C18H22ClNO |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 6-[2-(2-bicyclo[2.2.1]heptanyl)-1-chloroethyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(Cl)CC3CC4CCC3C4)ccc2N1 |
| InChI | InChI=1S/C18H22ClNO/c19-16(10-15-8-11-1-2-12(15)7-11)13-3-5-17-14(9-13)4-6-18(21)20-17/h3,5,9,11-12,15-16H,1-2,4,6-8,10H2,(H,20,21) |
| InChIKey | SVLBETJSLBSNFJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|