C18H18ClNO — CID 61083968
6-[1-chloro-2-(4-methylphenyl)ethyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 61083968) has the molecular formula C18H18ClNO and a molecular weight of 299.80 g/mol. Its IUPAC name is 6-[1-chloro-2-(4-methylphenyl)ethyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[1-chloro-2-(4-methylphenyl)ethyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 61083968 |
| Molecular Formula | C18H18ClNO |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 6-[1-chloro-2-(4-methylphenyl)ethyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1ccc(CC(Cl)c2ccc3c(c2)CCC(=O)N3)cc1 |
| InChI | InChI=1S/C18H18ClNO/c1-12-2-4-13(5-3-12)10-16(19)14-6-8-17-15(11-14)7-9-18(21)20-17/h2-6,8,11,16H,7,9-10H2,1H3,(H,20,21) |
| InChIKey | WDCQGKKPPZEEBM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|