C25H28ClN3O4 — CID 21428656
2-[3-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propyl-methylamino]propyl]-4H-isoquinoline-1,3-dione;hydrochloride (PubChem CID 21428656) has the molecular formula C25H28ClN3O4 and a molecular weight of 469.97 g/mol. Its IUPAC name is 2-[3-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propyl-methylamino]propyl]-4H-isoquinoline-1,3-dione;hydrochloride.
| Compound Name | 2-[3-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propyl-methylamino]propyl]-4H-isoquinoline-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 21428656 |
| Molecular Formula | C25H28ClN3O4 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 2-[3-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propyl-methylamino]propyl]-4H-isoquinoline-1,3-dione;hydrochloride |
| SMILES | CN(CCCN1C(=O)Cc2ccccc2C1=O)CCCN1C(=O)Cc2ccccc2C1=O.Cl |
| InChI | InChI=1S/C25H27N3O4.ClH/c1-26(12-6-14-27-22(29)16-18-8-2-4-10-20(18)24(27)31)13-7-15-28-23(30)17-19-9-3-5-11-21(19)25(28)32;/h2-5,8-11H,6-7,12-17H2,1H3;1H |
| InChIKey | LOPRLJQBDURQJG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|