C21H22N2O3 — CID 9379046
3-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methyl-N-[(2-methylphenyl)methyl]propanamide (PubChem CID 9379046) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methyl-N-[(2-methylphenyl)methyl]propanamide.
| Compound Name | 3-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methyl-N-[(2-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 9379046 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methyl-N-[(2-methylphenyl)methyl]propanamide |
| SMILES | Cc1ccccc1CN(C)C(=O)CCN1C(=O)Cc2ccccc2C1=O |
| InChI | InChI=1S/C21H22N2O3/c1-15-7-3-4-9-17(15)14-22(2)19(24)11-12-23-20(25)13-16-8-5-6-10-18(16)21(23)26/h3-10H,11-14H2,1-2H3 |
| InChIKey | GFNUGHWQZZVSHK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|