C23H24N2O4 — CID 9153474
3-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methyl-N-[(4-prop-2-enoxyphenyl)methyl]propanamide (PubChem CID 9153474) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methyl-N-[(4-prop-2-enoxyphenyl)methyl]propanamide.
| Compound Name | 3-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methyl-N-[(4-prop-2-enoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 9153474 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methyl-N-[(4-prop-2-enoxyphenyl)methyl]propanamide |
| SMILES | C=CCOc1ccc(CN(C)C(=O)CCN2C(=O)Cc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-3-14-29-19-10-8-17(9-11-19)16-24(2)21(26)12-13-25-22(27)15-18-6-4-5-7-20(18)23(25)28/h3-11H,1,12-16H2,2H3 |
| InChIKey | RNQGOQNMTOHFLI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|