C13H15NO3 — CID 20551260
2-(3-methoxypropyl)-4H-isoquinoline-1,3-dione (PubChem CID 20551260) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-4H-isoquinoline-1,3-dione.
| Compound Name | 2-(3-methoxypropyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 20551260 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-(3-methoxypropyl)-4H-isoquinoline-1,3-dione |
| SMILES | COCCCN1C(=O)Cc2ccccc2C1=O |
| InChI | InChI=1S/C13H15NO3/c1-17-8-4-7-14-12(15)9-10-5-2-3-6-11(10)13(14)16/h2-3,5-6H,4,7-9H2,1H3 |
| InChIKey | VVMOBJQQPOKOII-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|