C10H8BF3NO2- — CID 63703881
(1,3-dioxo-4H-isoquinolin-2-yl)methyl-trifluoroboranuide (PubChem CID 63703881) has the molecular formula C10H8BF3NO2- and a molecular weight of 241.99 g/mol. Its IUPAC name is (1,3-dioxo-4H-isoquinolin-2-yl)methyl-trifluoroboranuide.
| Compound Name | (1,3-dioxo-4H-isoquinolin-2-yl)methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 63703881 |
| Molecular Formula | C10H8BF3NO2- |
| Molecular Weight | 241.99 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (1,3-dioxo-4H-isoquinolin-2-yl)methyl-trifluoroboranuide |
| SMILES | O=C1Cc2ccccc2C(=O)N1C[B-](F)(F)F |
| InChI | InChI=1S/C10H8BF3NO2/c12-11(13,14)6-15-9(16)5-7-3-1-2-4-8(7)10(15)17/h1-4H,5-6H2/q-1 |
| InChIKey | ZMRNMDVPXCYUNU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.99 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|