C19H17BrN3O4+ — CID 2203607
[amino-(4-bromophenyl)methylidene]-[4-(1,3-dioxoisoindol-2-yl)butanoyloxy]azanium (PubChem CID 2203607) has the molecular formula C19H17BrN3O4+ and a molecular weight of 431.27 g/mol. Its IUPAC name is [amino-(4-bromophenyl)methylidene]-[4-(1,3-dioxoisoindol-2-yl)butanoyloxy]azanium.
| Compound Name | [amino-(4-bromophenyl)methylidene]-[4-(1,3-dioxoisoindol-2-yl)butanoyloxy]azanium |
|---|---|
| PubChem CID | 2203607 |
| Molecular Formula | C19H17BrN3O4+ |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | [amino-(4-bromophenyl)methylidene]-[4-(1,3-dioxoisoindol-2-yl)butanoyloxy]azanium |
| SMILES | NC(=[NH+]OC(=O)CCCN1C(=O)c2ccccc2C1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H16BrN3O4/c20-13-9-7-12(8-10-13)17(21)22-27-16(24)6-3-11-23-18(25)14-4-1-2-5-15(14)19(23)26/h1-2,4-5,7-10H,3,6,11H2,(H2,21,22)/p+1 |
| InChIKey | ZSVRGEYZPLGAAN-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|