C40H40FNO9 — CID 175334181
6-(1,3-dioxoisoindol-2-yl)hexanoic acid;2,2-diphenylpropanoic acid;5-(4-fluorophenyl)-5-oxopentanoic acid (PubChem CID 175334181) has the molecular formula C40H40FNO9 and a molecular weight of 697.76 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)hexanoic acid;2,2-diphenylpropanoic acid;5-(4-fluorophenyl)-5-oxopentanoic acid.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)hexanoic acid;2,2-diphenylpropanoic acid;5-(4-fluorophenyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175334181 |
| Molecular Formula | C40H40FNO9 |
| Molecular Weight | 697.76 g/mol |
| Exact Mass | 697.27 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)hexanoic acid;2,2-diphenylpropanoic acid;5-(4-fluorophenyl)-5-oxopentanoic acid |
| SMILES | CC(C(=O)O)(c1ccccc1)c1ccccc1.O=C(O)CCCC(=O)c1ccc(F)cc1.O=C(O)CCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H14O2.C14H15NO4.C11H11FO3/c1-15(14(16)17,12-8-4-2-5-9-12)13-10-6-3-7-11-13;16-12(17)8-2-1-5-9-15-13(18)10-6-3-4-7-11(10)14(15)19;12-9-6-4-8(5-7-9)10(13)2-1-3-11(14)15/h2-11H,1H3,(H,16,17);3-4,6-7H,1-2,5,8-9H2,(H,16,17);4-7H,1-3H2,(H,14,15) |
| InChIKey | AFDVACCONDIHIU-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 166.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.76 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|