C22H22F2O6 — CID 158005228
fluorobenzene;5-(4-fluorophenyl)-5-oxopentanoic acid;oxane-2,6-dione (PubChem CID 158005228) has the molecular formula C22H22F2O6 and a molecular weight of 420.41 g/mol. Its IUPAC name is fluorobenzene;5-(4-fluorophenyl)-5-oxopentanoic acid;oxane-2,6-dione.
| Compound Name | fluorobenzene;5-(4-fluorophenyl)-5-oxopentanoic acid;oxane-2,6-dione |
|---|---|
| PubChem CID | 158005228 |
| Molecular Formula | C22H22F2O6 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | fluorobenzene;5-(4-fluorophenyl)-5-oxopentanoic acid;oxane-2,6-dione |
| SMILES | Fc1ccccc1.O=C(O)CCCC(=O)c1ccc(F)cc1.O=C1CCCC(=O)O1 |
| InChI | InChI=1S/C11H11FO3.C6H5F.C5H6O3/c12-9-6-4-8(5-7-9)10(13)2-1-3-11(14)15;7-6-4-2-1-3-5-6;6-4-2-1-3-5(7)8-4/h4-7H,1-3H2,(H,14,15);1-5H;1-3H2 |
| InChIKey | FEFDHJQDSHQVMP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|