C16H16N2O4 — CID 130193152
2-[(2E,4E)-5-methoxy-2-methyl-5-(methylideneamino)penta-2,4-dienoxy]isoindole-1,3-dione (PubChem CID 130193152) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[(2E,4E)-5-methoxy-2-methyl-5-(methylideneamino)penta-2,4-dienoxy]isoindole-1,3-dione.
| Compound Name | 2-[(2E,4E)-5-methoxy-2-methyl-5-(methylideneamino)penta-2,4-dienoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 130193152 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[(2E,4E)-5-methoxy-2-methyl-5-(methylideneamino)penta-2,4-dienoxy]isoindole-1,3-dione |
| SMILES | C=N/C(=C\C=C(/C)CON1C(=O)c2ccccc2C1=O)OC |
| InChI | InChI=1S/C16H16N2O4/c1-11(8-9-14(17-2)21-3)10-22-18-15(19)12-6-4-5-7-13(12)16(18)20/h4-9H,2,10H2,1,3H3/b11-8+,14-9+ |
| InChIKey | NTNWSSASMVKKLN-GBMJPCLJSA-N |
| XLogP | 2.35 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|