C14H11NO3 — CID 15022280
2-[(E)-3-methylpent-2-en-4-ynoxy]isoindole-1,3-dione (PubChem CID 15022280) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-[(E)-3-methylpent-2-en-4-ynoxy]isoindole-1,3-dione.
| Compound Name | 2-[(E)-3-methylpent-2-en-4-ynoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15022280 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-[(E)-3-methylpent-2-en-4-ynoxy]isoindole-1,3-dione |
| SMILES | C#C/C(C)=C/CON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H11NO3/c1-3-10(2)8-9-18-15-13(16)11-6-4-5-7-12(11)14(15)17/h1,4-8H,9H2,2H3/b10-8+ |
| InChIKey | DFROOLNMZXWCHD-CSKARUKUSA-N |
| XLogP | 1.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|