[(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid

C12H12N2O5 — CID 134279344

IUPAC[(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid
SMILESC[C@H](CON1C(=O)c2ccccc2C1=O)NC(=O)O
InChIInChI=1S/C12H12N2O5/c1-7(13-12(17)18)6-19-14-10(15)8-4-2-3-5-9(8)11(14)16/h2-5,7,13H,6H2,1H3,(H,17,18)/t7-/m1/s1
InChIKeyMLTIQQXLCSQNAL-SSDOTTSWSA-N
MW264.24 g/mol
LogP0.87
Rot. Bonds4

About [(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid

[(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid (PubChem CID 134279344) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is [(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid.

Molecular Properties

Compound Name[(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid
PubChem CID134279344
Molecular FormulaC12H12N2O5
Molecular Weight264.24 g/mol
Exact Mass264.07
IUPAC Name[(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid
SMILESC[C@H](CON1C(=O)c2ccccc2C1=O)NC(=O)O
InChIInChI=1S/C12H12N2O5/c1-7(13-12(17)18)6-19-14-10(15)8-4-2-3-5-9(8)11(14)16/h2-5,7,13H,6H2,1H3,(H,17,18)/t7-/m1/s1
InChIKeyMLTIQQXLCSQNAL-SSDOTTSWSA-N
XLogP0.87
TPSA95.94 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.24
LogP ≤ 50.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze [(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid?
The IUPAC name of [(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid (CID 134279344) is [(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid.
What is the SMILES notation for [(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid?
The canonical SMILES for [(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid is C[C@H](CON1C(=O)c2ccccc2C1=O)NC(=O)O.
What is the InChIKey of [(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid?
The InChIKey is MLTIQQXLCSQNAL-SSDOTTSWSA-N. The full InChI is InChI=1S/C12H12N2O5/c1-7(13-12(17)18)6-19-14-10(15)8-4-2-3-5-9(8)11(14)16/h2-5,7,13H,6H2,1H3,(H,17,18)/t7-/m1/s1.
What are the key properties of [(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid?
[(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid has a molecular weight of 264.24 g/mol, XLogP of 0.87, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-(1,3-dioxoisoindol-2-yl)oxypropan-2-yl]carbamic acid is sourced from PubChem (CID 134279344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).