About diethoxyphosphorylmethyl 2-methoxybenzoate
diethoxyphosphorylmethyl 2-methoxybenzoate (PubChem CID 57457787) has the molecular formula C13H19O6P
and a molecular weight of 302.26 g/mol. Its IUPAC name is diethoxyphosphorylmethyl 2-methoxybenzoate.
Molecular Properties
| Compound Name | diethoxyphosphorylmethyl 2-methoxybenzoate |
| PubChem CID | 57457787 |
| Molecular Formula | C13H19O6P |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | diethoxyphosphorylmethyl 2-methoxybenzoate |
| SMILES | CCOP(=O)(COC(=O)c1ccccc1OC)OCC |
| InChI | InChI=1S/C13H19O6P/c1-4-18-20(15,19-5-2)10-17-13(14)11-8-6-7-9-12(11)16-3/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | MGRCFKQGERJMCY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxyphosphorylmethyl 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxyphosphorylmethyl 2-methoxybenzoate?
The IUPAC name of diethoxyphosphorylmethyl 2-methoxybenzoate (CID 57457787) is diethoxyphosphorylmethyl 2-methoxybenzoate.
What is the SMILES notation for diethoxyphosphorylmethyl 2-methoxybenzoate?
The canonical SMILES for diethoxyphosphorylmethyl 2-methoxybenzoate is CCOP(=O)(COC(=O)c1ccccc1OC)OCC.
What is the InChIKey of diethoxyphosphorylmethyl 2-methoxybenzoate?
The InChIKey is MGRCFKQGERJMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19O6P/c1-4-18-20(15,19-5-2)10-17-13(14)11-8-6-7-9-12(11)16-3/h6-9H,4-5,10H2,1-3H3.
What are the key properties of diethoxyphosphorylmethyl 2-methoxybenzoate?
diethoxyphosphorylmethyl 2-methoxybenzoate has a molecular weight of 302.26 g/mol, XLogP of 3.08, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxyphosphorylmethyl 2-methoxybenzoate is sourced from PubChem (CID 57457787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).