About 2-oxoethyl 2-methoxybenzoate
2-oxoethyl 2-methoxybenzoate (PubChem CID 87871956) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-oxoethyl 2-methoxybenzoate.
Molecular Properties
| Compound Name | 2-oxoethyl 2-methoxybenzoate |
| PubChem CID | 87871956 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-oxoethyl 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OCC=O |
| InChI | InChI=1S/C10H10O4/c1-13-9-5-3-2-4-8(9)10(12)14-7-6-11/h2-6H,7H2,1H3 |
| InChIKey | TUNMXLDIWAPIIP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-oxoethyl 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoethyl 2-methoxybenzoate?
The IUPAC name of 2-oxoethyl 2-methoxybenzoate (CID 87871956) is 2-oxoethyl 2-methoxybenzoate.
What is the SMILES notation for 2-oxoethyl 2-methoxybenzoate?
The canonical SMILES for 2-oxoethyl 2-methoxybenzoate is COc1ccccc1C(=O)OCC=O.
What is the InChIKey of 2-oxoethyl 2-methoxybenzoate?
The InChIKey is TUNMXLDIWAPIIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4/c1-13-9-5-3-2-4-8(9)10(12)14-7-6-11/h2-6H,7H2,1H3.
What are the key properties of 2-oxoethyl 2-methoxybenzoate?
2-oxoethyl 2-methoxybenzoate has a molecular weight of 194.19 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoethyl 2-methoxybenzoate is sourced from PubChem (CID 87871956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).