C16H15N2O3+ — CID 5163432
2-[2-(4-methylpyridin-1-ium-1-yl)ethoxy]isoindole-1,3-dione (PubChem CID 5163432) has the molecular formula C16H15N2O3+ and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-[2-(4-methylpyridin-1-ium-1-yl)ethoxy]isoindole-1,3-dione.
| Compound Name | 2-[2-(4-methylpyridin-1-ium-1-yl)ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 5163432 |
| Molecular Formula | C16H15N2O3+ |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-[2-(4-methylpyridin-1-ium-1-yl)ethoxy]isoindole-1,3-dione |
| SMILES | Cc1cc[n+](CCON2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C16H15N2O3/c1-12-6-8-17(9-7-12)10-11-21-18-15(19)13-4-2-3-5-14(13)16(18)20/h2-9H,10-11H2,1H3/q+1 |
| InChIKey | YDVOJXQOHALCAF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|