C17H18N6O3 — CID 4665640
2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-[(4-methylphenyl)methylideneamino]acetamide (PubChem CID 4665640) has the molecular formula C17H18N6O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-[(4-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-[(4-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4665640 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-[(4-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(C=NNC(=O)Cn2cnc3c(=O)n(C)c(=O)n(C)c32)cc1 |
| InChI | InChI=1S/C17H18N6O3/c1-11-4-6-12(7-5-11)8-19-20-13(24)9-23-10-18-14-15(23)21(2)17(26)22(3)16(14)25/h4-8,10H,9H2,1-3H3,(H,20,24) |
| InChIKey | JLUMHCGYJKMMKN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|