C20H24N8O5 — CID 6005882
N-[(Z)-[4-(diethylamino)-3-nitrophenyl]methylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide (PubChem CID 6005882) has the molecular formula C20H24N8O5 and a molecular weight of 456.46 g/mol. Its IUPAC name is N-[(Z)-[4-(diethylamino)-3-nitrophenyl]methylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide.
| Compound Name | N-[(Z)-[4-(diethylamino)-3-nitrophenyl]methylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide |
|---|---|
| PubChem CID | 6005882 |
| Molecular Formula | C20H24N8O5 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | N-[(Z)-[4-(diethylamino)-3-nitrophenyl]methylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)Cn2cnc3c(=O)n(C)c(=O)n(C)c32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H24N8O5/c1-5-26(6-2)14-8-7-13(9-15(14)28(32)33)10-22-23-16(29)11-27-12-21-17-18(27)24(3)20(31)25(4)19(17)30/h7-10,12H,5-6,11H2,1-4H3,(H,23,29)/b22-10- |
| InChIKey | NMSDGMAEBSIXFV-YVNNLAQVSA-N |
| XLogP | 0.34 |
| TPSA | 149.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|