C26H29N5O6S — CID 46501180
2-[N-(benzenesulfonyl)-2-methoxyanilino]-N-[(E)-[4-(diethylamino)-3-nitrophenyl]methylideneamino]acetamide (PubChem CID 46501180) has the molecular formula C26H29N5O6S and a molecular weight of 539.61 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-methoxyanilino]-N-[(E)-[4-(diethylamino)-3-nitrophenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-methoxyanilino]-N-[(E)-[4-(diethylamino)-3-nitrophenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 46501180 |
| Molecular Formula | C26H29N5O6S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-methoxyanilino]-N-[(E)-[4-(diethylamino)-3-nitrophenyl]methylideneamino]acetamide |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)CN(c2ccccc2OC)S(=O)(=O)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H29N5O6S/c1-4-29(5-2)22-16-15-20(17-24(22)31(33)34)18-27-28-26(32)19-30(23-13-9-10-14-25(23)37-3)38(35,36)21-11-7-6-8-12-21/h6-18H,4-5,19H2,1-3H3,(H,28,32)/b27-18+ |
| InChIKey | FHIUFJRABYNFOF-OVVQPSECSA-N |
| XLogP | 3.80 |
| TPSA | 134.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|