C17H17BrN6O5 — CID 135615224
N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide (PubChem CID 135615224) has the molecular formula C17H17BrN6O5 and a molecular weight of 465.26 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide.
| Compound Name | N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide |
|---|---|
| PubChem CID | 135615224 |
| Molecular Formula | C17H17BrN6O5 |
| Molecular Weight | 465.26 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cn2cnc3c(=O)n(C)c(=O)n(C)c32)cc(Br)c1O |
| InChI | InChI=1S/C17H17BrN6O5/c1-22-15-13(16(27)23(2)17(22)28)19-8-24(15)7-12(25)21-20-6-9-4-10(18)14(26)11(5-9)29-3/h4-6,8,26H,7H2,1-3H3,(H,21,25)/b20-6+ |
| InChIKey | VYXJRUPWVMMLKP-CGOBSMCZSA-N |
| XLogP | 0.06 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|