C11H13N5O2 — CID 162419679
4-(1,3-dimethyl-2,6-dioxopurin-9-yl)butanenitrile (PubChem CID 162419679) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-(1,3-dimethyl-2,6-dioxopurin-9-yl)butanenitrile.
| Compound Name | 4-(1,3-dimethyl-2,6-dioxopurin-9-yl)butanenitrile |
|---|---|
| PubChem CID | 162419679 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-(1,3-dimethyl-2,6-dioxopurin-9-yl)butanenitrile |
| SMILES | Cn1c(=O)c2ncn(CCCC#N)c2n(C)c1=O |
| InChI | InChI=1S/C11H13N5O2/c1-14-9-8(10(17)15(2)11(14)18)13-7-16(9)6-4-3-5-12/h7H,3-4,6H2,1-2H3 |
| InChIKey | RGUXGJJKRKLDGR-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|