C19H24ClN9O3 — CID 11662619
(1Z)-1-[amino-[4-(1,3-dimethyl-2,6-dioxopurin-9-yl)butoxyamino]methylidene]-2-(4-chlorophenyl)guanidine (PubChem CID 11662619) has the molecular formula C19H24ClN9O3 and a molecular weight of 461.91 g/mol. Its IUPAC name is (1Z)-1-[amino-[4-(1,3-dimethyl-2,6-dioxopurin-9-yl)butoxyamino]methylidene]-2-(4-chlorophenyl)guanidine.
| Compound Name | (1Z)-1-[amino-[4-(1,3-dimethyl-2,6-dioxopurin-9-yl)butoxyamino]methylidene]-2-(4-chlorophenyl)guanidine |
|---|---|
| PubChem CID | 11662619 |
| Molecular Formula | C19H24ClN9O3 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (1Z)-1-[amino-[4-(1,3-dimethyl-2,6-dioxopurin-9-yl)butoxyamino]methylidene]-2-(4-chlorophenyl)guanidine |
| SMILES | Cn1c(=O)c2ncn(CCCCON/C(N)=N\C(N)=N\c3ccc(Cl)cc3)c2n(C)c1=O |
| InChI | InChI=1S/C19H24ClN9O3/c1-27-15-14(16(30)28(2)19(27)31)23-11-29(15)9-3-4-10-32-26-18(22)25-17(21)24-13-7-5-12(20)6-8-13/h5-8,11H,3-4,9-10H2,1-2H3,(H5,21,22,24,25,26) |
| InChIKey | XPKJLCXJYJQYPM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 159.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|