C25H30N4O5 — CID 126259118
N-[[(2S)-oxolan-2-yl]methyl]-N'-[(Z)-[3-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126259118) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-N'-[(Z)-[3-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-N'-[(Z)-[3-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126259118 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-N'-[(Z)-[3-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide |
| SMILES | Cc1cc(C)c(NC(=O)COc2cccc(/C=N\NC(=O)C(=O)NC[C@@H]3CCCO3)c2)c(C)c1 |
| InChI | InChI=1S/C25H30N4O5/c1-16-10-17(2)23(18(3)11-16)28-22(30)15-34-20-7-4-6-19(12-20)13-27-29-25(32)24(31)26-14-21-8-5-9-33-21/h4,6-7,10-13,21H,5,8-9,14-15H2,1-3H3,(H,26,31)(H,28,30)(H,29,32)/b27-13-/t21-/m0/s1 |
| InChIKey | AAZSLPFUDPSPIM-DGBIYHDASA-N |
| XLogP | 2.37 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|