C18H13Br2Cl2N3O3 — CID 126001686
2-cyano-N-[(Z)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide (PubChem CID 126001686) has the molecular formula C18H13Br2Cl2N3O3 and a molecular weight of 550.03 g/mol. Its IUPAC name is 2-cyano-N-[(Z)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-cyano-N-[(Z)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126001686 |
| Molecular Formula | C18H13Br2Cl2N3O3 |
| Molecular Weight | 550.03 g/mol |
| Exact Mass | 546.87 |
| IUPAC Name | 2-cyano-N-[(Z)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CC#N)c(Br)c(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Br2Cl2N3O3/c1-27-14-7-11(8-24-25-15(26)4-5-23)16(19)17(20)18(14)28-9-10-2-3-12(21)13(22)6-10/h2-3,6-8H,4,9H2,1H3,(H,25,26)/b24-8- |
| InChIKey | IJLLATBRAVIMIJ-GYRAYZOKSA-N |
| XLogP | 5.47 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.03 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|