C13H11BrN3O5- — CID 7264250
2-[5-bromo-4-[(Z)-[(2-cyanoacetyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 7264250) has the molecular formula C13H11BrN3O5- and a molecular weight of 369.15 g/mol. Its IUPAC name is 2-[5-bromo-4-[(Z)-[(2-cyanoacetyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | 2-[5-bromo-4-[(Z)-[(2-cyanoacetyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 7264250 |
| Molecular Formula | C13H11BrN3O5- |
| Molecular Weight | 369.15 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 2-[5-bromo-4-[(Z)-[(2-cyanoacetyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | COc1cc(/C=N\NC(=O)CC#N)c(Br)cc1OCC(=O)[O-] |
| InChI | InChI=1S/C13H12BrN3O5/c1-21-10-4-8(6-16-17-12(18)2-3-15)9(14)5-11(10)22-7-13(19)20/h4-6H,2,7H2,1H3,(H,17,18)(H,19,20)/p-1/b16-6- |
| InChIKey | LQEGOJUULOCJIM-SOFYXZRVSA-M |
| XLogP | -0.05 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|