C24H24N2O7 — CID 19226593
[4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]-2-methoxyphenyl] 3,4-dimethoxybenzoate (PubChem CID 19226593) has the molecular formula C24H24N2O7 and a molecular weight of 452.46 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]-2-methoxyphenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]-2-methoxyphenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 19226593 |
| Molecular Formula | C24H24N2O7 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]-2-methoxyphenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=C(\C#N)C(=O)N3CCOCC3)cc2OC)cc1OC |
| InChI | InChI=1S/C24H24N2O7/c1-29-19-7-5-17(14-22(19)31-3)24(28)33-20-6-4-16(13-21(20)30-2)12-18(15-25)23(27)26-8-10-32-11-9-26/h4-7,12-14H,8-11H2,1-3H3/b18-12+ |
| InChIKey | KIAXFLLOBMVXHJ-LDADJPATSA-N |
| XLogP | 2.70 |
| TPSA | 107.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|