C25H19BrN2O7 — CID 19227465
[4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]-2-methoxyphenyl] 6-bromo-2-oxochromene-3-carboxylate (PubChem CID 19227465) has the molecular formula C25H19BrN2O7 and a molecular weight of 539.34 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]-2-methoxyphenyl] 6-bromo-2-oxochromene-3-carboxylate.
| Compound Name | [4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]-2-methoxyphenyl] 6-bromo-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 19227465 |
| Molecular Formula | C25H19BrN2O7 |
| Molecular Weight | 539.34 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | [4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]-2-methoxyphenyl] 6-bromo-2-oxochromene-3-carboxylate |
| SMILES | COc1cc(/C=C(\C#N)C(=O)N2CCOCC2)ccc1OC(=O)c1cc2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C25H19BrN2O7/c1-32-22-11-15(10-17(14-27)23(29)28-6-8-33-9-7-28)2-4-21(22)35-25(31)19-13-16-12-18(26)3-5-20(16)34-24(19)30/h2-5,10-13H,6-9H2,1H3/b17-10+ |
| InChIKey | GEQRWHQLLQEGFW-LICLKQGHSA-N |
| XLogP | 3.55 |
| TPSA | 119.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|