C26H23BrN2O4 — CID 126092025
(Z)-3-[2-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile (PubChem CID 126092025) has the molecular formula C26H23BrN2O4 and a molecular weight of 507.38 g/mol. Its IUPAC name is (Z)-3-[2-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[2-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126092025 |
| Molecular Formula | C26H23BrN2O4 |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | (Z)-3-[2-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)C(=O)N2CCOCC2)c(Br)cc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C26H23BrN2O4/c1-31-24-14-20(13-21(16-28)26(30)29-9-11-32-12-10-29)23(27)15-25(24)33-17-19-7-4-6-18-5-2-3-8-22(18)19/h2-8,13-15H,9-12,17H2,1H3/b21-13- |
| InChIKey | ZLWSVAZVENSJSY-BKUYFWCQSA-N |
| XLogP | 4.96 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|