C29H27BrN4O5 — CID 124534336
(Z)-3-[2-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 124534336) has the molecular formula C29H27BrN4O5 and a molecular weight of 591.46 g/mol. Its IUPAC name is (Z)-3-[2-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[2-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124534336 |
| Molecular Formula | C29H27BrN4O5 |
| Molecular Weight | 591.46 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | (Z)-3-[2-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)N2CCN(c3ccccc3)CC2)c(Br)cc1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H27BrN4O5/c1-2-38-27-17-22(26(30)18-28(27)39-20-21-7-6-10-25(15-21)34(36)37)16-23(19-31)29(35)33-13-11-32(12-14-33)24-8-4-3-5-9-24/h3-10,15-18H,2,11-14,20H2,1H3/b23-16- |
| InChIKey | PJAOJUZGZWDLIJ-KQWNVCNZSA-N |
| XLogP | 5.59 |
| TPSA | 108.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|