C27H22Br2FN3O2 — CID 124534185
(Z)-3-[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 124534185) has the molecular formula C27H22Br2FN3O2 and a molecular weight of 599.30 g/mol. Its IUPAC name is (Z)-3-[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124534185 |
| Molecular Formula | C27H22Br2FN3O2 |
| Molecular Weight | 599.30 g/mol |
| Exact Mass | 597.01 |
| IUPAC Name | (Z)-3-[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(Br)c(OCc2cccc(F)c2)c(Br)c1)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H22Br2FN3O2/c28-24-15-20(16-25(29)26(24)35-18-19-5-4-6-22(30)14-19)13-21(17-31)27(34)33-11-9-32(10-12-33)23-7-2-1-3-8-23/h1-8,13-16H,9-12,18H2/b21-13- |
| InChIKey | XWHYWDZRSYDBAH-BKUYFWCQSA-N |
| XLogP | 6.19 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.30 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|