C27H23BrN4O4 — CID 3850586
3-[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 3850586) has the molecular formula C27H23BrN4O4 and a molecular weight of 547.41 g/mol. Its IUPAC name is 3-[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | 3-[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3850586 |
| Molecular Formula | C27H23BrN4O4 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | 3-[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(OCc2cccc([N+](=O)[O-])c2)c(Br)c1)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H23BrN4O4/c28-25-17-20(9-10-26(25)36-19-21-5-4-8-24(16-21)32(34)35)15-22(18-29)27(33)31-13-11-30(12-14-31)23-6-2-1-3-7-23/h1-10,15-17H,11-14,19H2 |
| InChIKey | UQWFEPWBGKZRKP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 99.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|