C19H16BrN3O4 — CID 26479680
(Z)-3-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]-2-cyano-N,N-dimethylprop-2-enamide (PubChem CID 26479680) has the molecular formula C19H16BrN3O4 and a molecular weight of 430.26 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]-2-cyano-N,N-dimethylprop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]-2-cyano-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 26479680 |
| Molecular Formula | C19H16BrN3O4 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | (Z)-3-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]-2-cyano-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C(C#N)=C\c1ccc(OCc2ccc([N+](=O)[O-])cc2)c(Br)c1 |
| InChI | InChI=1S/C19H16BrN3O4/c1-22(2)19(24)15(11-21)9-14-5-8-18(17(20)10-14)27-12-13-3-6-16(7-4-13)23(25)26/h3-10H,12H2,1-2H3/b15-9- |
| InChIKey | OOVCEIPMVKNLCR-DHDCSXOGSA-N |
| XLogP | 3.93 |
| TPSA | 96.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|