C32H29N3O3 — CID 3812502
3-[3-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 3812502) has the molecular formula C32H29N3O3 and a molecular weight of 503.60 g/mol. Its IUPAC name is 3-[3-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | 3-[3-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3812502 |
| Molecular Formula | C32H29N3O3 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 3-[3-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)C(=O)N2CCN(c3ccccc3)CC2)ccc1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H29N3O3/c1-37-31-21-24(12-14-30(31)38-23-25-11-13-26-7-5-6-8-27(26)20-25)19-28(22-33)32(36)35-17-15-34(16-18-35)29-9-3-2-4-10-29/h2-14,19-21H,15-18,23H2,1H3 |
| InChIKey | VSWFDBRDWMBPPW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|