C31H25BrClN3O2 — CID 124534211
(Z)-3-[3-bromo-5-chloro-4-(naphthalen-2-ylmethoxy)phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 124534211) has the molecular formula C31H25BrClN3O2 and a molecular weight of 586.92 g/mol. Its IUPAC name is (Z)-3-[3-bromo-5-chloro-4-(naphthalen-2-ylmethoxy)phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[3-bromo-5-chloro-4-(naphthalen-2-ylmethoxy)phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124534211 |
| Molecular Formula | C31H25BrClN3O2 |
| Molecular Weight | 586.92 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | (Z)-3-[3-bromo-5-chloro-4-(naphthalen-2-ylmethoxy)phenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(Cl)c(OCc2ccc3ccccc3c2)c(Br)c1)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C31H25BrClN3O2/c32-28-18-23(19-29(33)30(28)38-21-22-10-11-24-6-4-5-7-25(24)16-22)17-26(20-34)31(37)36-14-12-35(13-15-36)27-8-2-1-3-9-27/h1-11,16-19H,12-15,21H2/b26-17- |
| InChIKey | JGYATBGCVMOTAN-ONUIUJJFSA-N |
| XLogP | 7.09 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.92 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|