C21H21N3O3 — CID 4603539
2-(morpholine-4-carbonyl)-3-(4-phenylmethoxyanilino)prop-2-enenitrile (PubChem CID 4603539) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-(morpholine-4-carbonyl)-3-(4-phenylmethoxyanilino)prop-2-enenitrile.
| Compound Name | 2-(morpholine-4-carbonyl)-3-(4-phenylmethoxyanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 4603539 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-(morpholine-4-carbonyl)-3-(4-phenylmethoxyanilino)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(OCc2ccccc2)cc1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H21N3O3/c22-14-18(21(25)24-10-12-26-13-11-24)15-23-19-6-8-20(9-7-19)27-16-17-4-2-1-3-5-17/h1-9,15,23H,10-13,16H2 |
| InChIKey | AGPIKVVSDSSRBX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|