C29H21Cl2IN2O3 — CID 124602631
(Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[3-ethoxy-5-iodo-4-(naphthalen-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 124602631) has the molecular formula C29H21Cl2IN2O3 and a molecular weight of 643.31 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[3-ethoxy-5-iodo-4-(naphthalen-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[3-ethoxy-5-iodo-4-(naphthalen-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 124602631 |
| Molecular Formula | C29H21Cl2IN2O3 |
| Molecular Weight | 643.31 g/mol |
| Exact Mass | 642.00 |
| IUPAC Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[3-ethoxy-5-iodo-4-(naphthalen-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2cccc(Cl)c2Cl)cc(I)c1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H21Cl2IN2O3/c1-2-36-26-15-19(13-22(16-33)29(35)34-25-9-5-8-23(30)27(25)31)14-24(32)28(26)37-17-18-10-11-20-6-3-4-7-21(20)12-18/h3-15H,2,17H2,1H3,(H,34,35)/b22-13- |
| InChIKey | RWCRDISZPXKOGR-XKZIYDEJSA-N |
| XLogP | 8.27 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.31 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|