C27H24ClIN2O3 — CID 98078248
(Z)-3-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 98078248) has the molecular formula C27H24ClIN2O3 and a molecular weight of 586.86 g/mol. Its IUPAC name is (Z)-3-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 98078248 |
| Molecular Formula | C27H24ClIN2O3 |
| Molecular Weight | 586.86 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | (Z)-3-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2ccc(C)cc2C)cc(I)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H24ClIN2O3/c1-4-33-25-14-20(13-23(29)26(25)34-16-19-6-8-22(28)9-7-19)12-21(15-30)27(32)31-24-10-5-17(2)11-18(24)3/h5-14H,4,16H2,1-3H3,(H,31,32)/b21-12- |
| InChIKey | JTMXULVSFXQBBS-MTJSOVHGSA-N |
| XLogP | 7.08 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.86 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|