C21H19ClIN3O4 — CID 71947288
3-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]-N-(4-chloro-2-methylphenyl)-2-cyanoprop-2-enamide (PubChem CID 71947288) has the molecular formula C21H19ClIN3O4 and a molecular weight of 539.76 g/mol. Its IUPAC name is 3-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]-N-(4-chloro-2-methylphenyl)-2-cyanoprop-2-enamide.
| Compound Name | 3-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]-N-(4-chloro-2-methylphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 71947288 |
| Molecular Formula | C21H19ClIN3O4 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.01 |
| IUPAC Name | 3-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]-N-(4-chloro-2-methylphenyl)-2-cyanoprop-2-enamide |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2ccc(Cl)cc2C)cc(I)c1OCC(N)=O |
| InChI | InChI=1S/C21H19ClIN3O4/c1-3-29-18-9-13(8-16(23)20(18)30-11-19(25)27)7-14(10-24)21(28)26-17-5-4-15(22)6-12(17)2/h4-9H,3,11H2,1-2H3,(H2,25,27)(H,26,28) |
| InChIKey | NPBHJUDPMFWHKN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|